C30H34O4 — CID 143039244
ethyl 2-[4-[(E)-3-(4-phenylphenyl)but-2-enoxy]phenoxy]hexanoate (PubChem CID 143039244) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-3-(4-phenylphenyl)but-2-enoxy]phenoxy]hexanoate.
| Compound Name | ethyl 2-[4-[(E)-3-(4-phenylphenyl)but-2-enoxy]phenoxy]hexanoate |
|---|---|
| PubChem CID | 143039244 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | ethyl 2-[4-[(E)-3-(4-phenylphenyl)but-2-enoxy]phenoxy]hexanoate |
| SMILES | CCCCC(Oc1ccc(OC/C=C(\C)c2ccc(-c3ccccc3)cc2)cc1)C(=O)OCC |
| InChI | InChI=1S/C30H34O4/c1-4-6-12-29(30(31)32-5-2)34-28-19-17-27(18-20-28)33-22-21-23(3)24-13-15-26(16-14-24)25-10-8-7-9-11-25/h7-11,13-21,29H,4-6,12,22H2,1-3H3/b23-21+ |
| InChIKey | GFOMWHOTZAWBJW-XTQSDGFTSA-N |
| XLogP | 7.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |