C32H38O4 — CID 22557617
ethyl 2-ethoxy-3-[4-[(E)-3-[4-(4-propan-2-ylphenyl)phenyl]but-2-enoxy]phenyl]propanoate (PubChem CID 22557617) has the molecular formula C32H38O4 and a molecular weight of 486.65 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[4-[(E)-3-[4-(4-propan-2-ylphenyl)phenyl]but-2-enoxy]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[4-[(E)-3-[4-(4-propan-2-ylphenyl)phenyl]but-2-enoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22557617 |
| Molecular Formula | C32H38O4 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | ethyl 2-ethoxy-3-[4-[(E)-3-[4-(4-propan-2-ylphenyl)phenyl]but-2-enoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC/C=C(\C)c2ccc(-c3ccc(C(C)C)cc3)cc2)cc1)OCC |
| InChI | InChI=1S/C32H38O4/c1-6-34-31(32(33)35-7-2)22-25-8-18-30(19-9-25)36-21-20-24(5)27-12-16-29(17-13-27)28-14-10-26(11-15-28)23(3)4/h8-20,23,31H,6-7,21-22H2,1-5H3/b24-20+ |
| InChIKey | DIQVQKCKWOJJRT-HIXSDJFHSA-N |
| XLogP | 7.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |