C30H34O6 — CID 10228222
ethyl 2-ethoxy-3-[4-[(E)-3-[4-(4-methoxyphenoxy)phenyl]but-2-enoxy]phenyl]propanoate (PubChem CID 10228222) has the molecular formula C30H34O6 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[4-[(E)-3-[4-(4-methoxyphenoxy)phenyl]but-2-enoxy]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[4-[(E)-3-[4-(4-methoxyphenoxy)phenyl]but-2-enoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 10228222 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | ethyl 2-ethoxy-3-[4-[(E)-3-[4-(4-methoxyphenoxy)phenyl]but-2-enoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC/C=C(\C)c2ccc(Oc3ccc(OC)cc3)cc2)cc1)OCC |
| InChI | InChI=1S/C30H34O6/c1-5-33-29(30(31)34-6-2)21-23-7-11-26(12-8-23)35-20-19-22(3)24-9-13-27(14-10-24)36-28-17-15-25(32-4)16-18-28/h7-19,29H,5-6,20-21H2,1-4H3/b22-19+ |
| InChIKey | DTSCMTRWAMRMAS-ZBJSNUHESA-N |
| XLogP | 6.48 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |