C28H30O5 — CID 10275435
ethyl 2-ethoxy-3-[4-[(E)-3-(3-phenoxyphenyl)prop-2-enoxy]phenyl]propanoate (PubChem CID 10275435) has the molecular formula C28H30O5 and a molecular weight of 446.54 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[4-[(E)-3-(3-phenoxyphenyl)prop-2-enoxy]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[4-[(E)-3-(3-phenoxyphenyl)prop-2-enoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 10275435 |
| Molecular Formula | C28H30O5 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | ethyl 2-ethoxy-3-[4-[(E)-3-(3-phenoxyphenyl)prop-2-enoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC/C=C/c2cccc(Oc3ccccc3)c2)cc1)OCC |
| InChI | InChI=1S/C28H30O5/c1-3-30-27(28(29)31-4-2)21-23-15-17-24(18-16-23)32-19-9-11-22-10-8-14-26(20-22)33-25-12-6-5-7-13-25/h5-18,20,27H,3-4,19,21H2,1-2H3/b11-9+ |
| InChIKey | SSAIWJRJLTUQFW-PKNBQFBNSA-N |
| XLogP | 6.08 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |