C26H32O8 — CID 91044572
2-ethoxy-3-[4-[4-[4-(3-ethoxy-2-hydroxy-3-oxopropyl)phenoxy]but-2-enoxy]phenyl]propanoic acid (PubChem CID 91044572) has the molecular formula C26H32O8 and a molecular weight of 472.53 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[4-[4-(3-ethoxy-2-hydroxy-3-oxopropyl)phenoxy]but-2-enoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[4-[4-(3-ethoxy-2-hydroxy-3-oxopropyl)phenoxy]but-2-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91044572 |
| Molecular Formula | C26H32O8 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 2-ethoxy-3-[4-[4-[4-(3-ethoxy-2-hydroxy-3-oxopropyl)phenoxy]but-2-enoxy]phenyl]propanoic acid |
| SMILES | CCOC(=O)C(O)Cc1ccc(OCC=CCOc2ccc(CC(OCC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H32O8/c1-3-31-24(25(28)29)18-20-9-13-22(14-10-20)34-16-6-5-15-33-21-11-7-19(8-12-21)17-23(27)26(30)32-4-2/h5-14,23-24,27H,3-4,15-18H2,1-2H3,(H,28,29) |
| InChIKey | QOPDGTINCCJBDJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|