C24H26O6 — CID 87842963
(2S)-3-[4-[(Z)-5-(3,5-dimethoxyphenyl)pent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 87842963) has the molecular formula C24H26O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2S)-3-[4-[(Z)-5-(3,5-dimethoxyphenyl)pent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[(Z)-5-(3,5-dimethoxyphenyl)pent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 87842963 |
| Molecular Formula | C24H26O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (2S)-3-[4-[(Z)-5-(3,5-dimethoxyphenyl)pent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OC/C=C\C#Cc2cc(OC)cc(OC)c2)cc1)C(=O)O |
| InChI | InChI=1S/C24H26O6/c1-4-29-23(24(25)26)16-18-9-11-20(12-10-18)30-13-7-5-6-8-19-14-21(27-2)17-22(15-19)28-3/h5,7,9-12,14-15,17,23H,4,13,16H2,1-3H3,(H,25,26)/b7-5-/t23-/m0/s1 |
| InChIKey | AIXJVDVWFQIOSD-DADDIACRSA-N |
| XLogP | 3.72 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|