C22H20Cl2O4 — CID 18522371
3-[4-[(E)-5-(3,5-dichlorophenyl)pent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 18522371) has the molecular formula C22H20Cl2O4 and a molecular weight of 419.30 g/mol. Its IUPAC name is 3-[4-[(E)-5-(3,5-dichlorophenyl)pent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[(E)-5-(3,5-dichlorophenyl)pent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 18522371 |
| Molecular Formula | C22H20Cl2O4 |
| Molecular Weight | 419.30 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 3-[4-[(E)-5-(3,5-dichlorophenyl)pent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OC/C=C/C#Cc2cc(Cl)cc(Cl)c2)cc1)C(=O)O |
| InChI | InChI=1S/C22H20Cl2O4/c1-2-27-21(22(25)26)14-16-7-9-20(10-8-16)28-11-5-3-4-6-17-12-18(23)15-19(24)13-17/h3,5,7-10,12-13,15,21H,2,11,14H2,1H3,(H,25,26)/b5-3+ |
| InChIKey | IMMBCQQONYQDPO-HWKANZROSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.30 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|