C24H19F6IO4 — CID 20590905
(2S)-3-[4-[(E)-5-[3,5-bis(trifluoromethyl)phenyl]pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid (PubChem CID 20590905) has the molecular formula C24H19F6IO4 and a molecular weight of 612.30 g/mol. Its IUPAC name is (2S)-3-[4-[(E)-5-[3,5-bis(trifluoromethyl)phenyl]pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[(E)-5-[3,5-bis(trifluoromethyl)phenyl]pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 20590905 |
| Molecular Formula | C24H19F6IO4 |
| Molecular Weight | 612.30 g/mol |
| Exact Mass | 612.02 |
| IUPAC Name | (2S)-3-[4-[(E)-5-[3,5-bis(trifluoromethyl)phenyl]pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OC/C=C/C#Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C24H19F6IO4/c1-2-34-21(22(32)33)13-16-7-8-20(19(31)12-16)35-9-5-3-4-6-15-10-17(23(25,26)27)14-18(11-15)24(28,29)30/h3,5,7-8,10-12,14,21H,2,9,13H2,1H3,(H,32,33)/b5-3+/t21-/m0/s1 |
| InChIKey | DSJSZDJPUKFECB-GUWAZMKPSA-N |
| XLogP | 6.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.30 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|