C27H25F6IO6 — CID 87842130
(2S)-3-[4-[(E)-5-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid (PubChem CID 87842130) has the molecular formula C27H25F6IO6 and a molecular weight of 686.38 g/mol. Its IUPAC name is (2S)-3-[4-[(E)-5-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[(E)-5-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 87842130 |
| Molecular Formula | C27H25F6IO6 |
| Molecular Weight | 686.38 g/mol |
| Exact Mass | 686.06 |
| IUPAC Name | (2S)-3-[4-[(E)-5-[3,5-bis(2,2,2-trifluoroethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OC/C=C(\C)C#Cc2cc(OCC(F)(F)F)cc(OCC(F)(F)F)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C27H25F6IO6/c1-3-37-24(25(35)36)13-19-6-7-23(22(34)12-19)38-9-8-17(2)4-5-18-10-20(39-15-26(28,29)30)14-21(11-18)40-16-27(31,32)33/h6-8,10-12,14,24H,3,9,13,15-16H2,1-2H3,(H,35,36)/b17-8+/t24-/m0/s1 |
| InChIKey | KWSGNLFOICWEQW-FZRLKEFVSA-N |
| XLogP | 6.58 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.38 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|