C27H32O6 — CID 87841821
(2S)-3-[4-[(Z)-5-(3,5-diethoxyphenyl)-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 87841821) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is (2S)-3-[4-[(Z)-5-(3,5-diethoxyphenyl)-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[(Z)-5-(3,5-diethoxyphenyl)-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 87841821 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (2S)-3-[4-[(Z)-5-(3,5-diethoxyphenyl)-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOc1cc(C#C/C(C)=C\COc2ccc(C[C@H](OCC)C(=O)O)cc2)cc(OCC)c1 |
| InChI | InChI=1S/C27H32O6/c1-5-30-24-16-22(17-25(19-24)31-6-2)9-8-20(4)14-15-33-23-12-10-21(11-13-23)18-26(27(28)29)32-7-3/h10-14,16-17,19,26H,5-7,15,18H2,1-4H3,(H,28,29)/b20-14-/t26-/m0/s1 |
| InChIKey | QGRMTWQVDPPDKR-BHIHAWCJSA-N |
| XLogP | 4.89 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|