C25H22F6O6 — CID 10165452
3-[4-[(Z)-5-[3,5-bis(trifluoromethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 10165452) has the molecular formula C25H22F6O6 and a molecular weight of 532.43 g/mol. Its IUPAC name is 3-[4-[(Z)-5-[3,5-bis(trifluoromethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[(Z)-5-[3,5-bis(trifluoromethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 10165452 |
| Molecular Formula | C25H22F6O6 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 3-[4-[(Z)-5-[3,5-bis(trifluoromethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OC/C=C(/C)C#Cc2cc(OC(F)(F)F)cc(OC(F)(F)F)c2)cc1)C(=O)O |
| InChI | InChI=1S/C25H22F6O6/c1-3-34-22(23(32)33)14-17-6-8-19(9-7-17)35-11-10-16(2)4-5-18-12-20(36-24(26,27)28)15-21(13-18)37-25(29,30)31/h6-10,12-13,15,22H,3,11,14H2,1-2H3,(H,32,33)/b16-10- |
| InChIKey | DRFAWXBERLNUPY-YBEGLDIGSA-N |
| XLogP | 5.89 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|