C25H21BrF6O6 — CID 10211037
3-[4-[(Z)-5-[2,4-bis(trifluoromethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]-3-bromophenyl]-2-ethoxypropanoic acid (PubChem CID 10211037) has the molecular formula C25H21BrF6O6 and a molecular weight of 611.33 g/mol. Its IUPAC name is 3-[4-[(Z)-5-[2,4-bis(trifluoromethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]-3-bromophenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[(Z)-5-[2,4-bis(trifluoromethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]-3-bromophenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 10211037 |
| Molecular Formula | C25H21BrF6O6 |
| Molecular Weight | 611.33 g/mol |
| Exact Mass | 610.04 |
| IUPAC Name | 3-[4-[(Z)-5-[2,4-bis(trifluoromethoxy)phenyl]-3-methylpent-2-en-4-ynoxy]-3-bromophenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OC/C=C(/C)C#Cc2ccc(OC(F)(F)F)cc2OC(F)(F)F)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C25H21BrF6O6/c1-3-35-22(23(33)34)13-16-5-9-20(19(26)12-16)36-11-10-15(2)4-6-17-7-8-18(37-24(27,28)29)14-21(17)38-25(30,31)32/h5,7-10,12,14,22H,3,11,13H2,1-2H3,(H,33,34)/b15-10- |
| InChIKey | CXJMEFPBMIHNNJ-GDNBJRDFSA-N |
| XLogP | 6.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.33 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|