C23H21BrF2O4 — CID 90887874
(2S)-3-[3-bromo-4-[5-(3,5-difluorophenyl)-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 90887874) has the molecular formula C23H21BrF2O4 and a molecular weight of 479.32 g/mol. Its IUPAC name is (2S)-3-[3-bromo-4-[5-(3,5-difluorophenyl)-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[3-bromo-4-[5-(3,5-difluorophenyl)-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 90887874 |
| Molecular Formula | C23H21BrF2O4 |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | (2S)-3-[3-bromo-4-[5-(3,5-difluorophenyl)-3-methylpent-2-en-4-ynoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OCC=C(C)C#Cc2cc(F)cc(F)c2)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C23H21BrF2O4/c1-3-29-22(23(27)28)13-17-6-7-21(20(24)12-17)30-9-8-15(2)4-5-16-10-18(25)14-19(26)11-16/h6-8,10-12,14,22H,3,9,13H2,1-2H3,(H,27,28)/t22-/m0/s1 |
| InChIKey | QKEOMYLLGRAUSN-QFIPXVFZSA-N |
| XLogP | 5.14 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|