C23H24O4 — CID 91039422
(2S)-2-ethoxy-3-[4-(3-methyl-5-phenylpent-2-en-4-ynoxy)phenyl]propanoic acid (PubChem CID 91039422) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-(3-methyl-5-phenylpent-2-en-4-ynoxy)phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-(3-methyl-5-phenylpent-2-en-4-ynoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 91039422 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-(3-methyl-5-phenylpent-2-en-4-ynoxy)phenyl]propanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OCC=C(C)C#Cc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C23H24O4/c1-3-26-22(23(24)25)17-20-11-13-21(14-12-20)27-16-15-18(2)9-10-19-7-5-4-6-8-19/h4-8,11-15,22H,3,16-17H2,1-2H3,(H,24,25)/t22-/m0/s1 |
| InChIKey | MFQIQMISMHBYLM-QFIPXVFZSA-N |
| XLogP | 4.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|