C25H28O4 — CID 58841872
ethyl 2-ethoxy-3-[3-[(E)-3-methyl-5-phenylpent-2-en-4-ynoxy]phenyl]propanoate (PubChem CID 58841872) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[3-[(E)-3-methyl-5-phenylpent-2-en-4-ynoxy]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[3-[(E)-3-methyl-5-phenylpent-2-en-4-ynoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 58841872 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | ethyl 2-ethoxy-3-[3-[(E)-3-methyl-5-phenylpent-2-en-4-ynoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1cccc(OC/C=C(\C)C#Cc2ccccc2)c1)OCC |
| InChI | InChI=1S/C25H28O4/c1-4-27-24(25(26)28-5-2)19-22-12-9-13-23(18-22)29-17-16-20(3)14-15-21-10-7-6-8-11-21/h6-13,16,18,24H,4-5,17,19H2,1-3H3/b20-16+ |
| InChIKey | QSMZANQFJZSTOW-CAPFRKAQSA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|