C38H34O4 — CID 10280973
ethyl 3-[4-[(E)-3-[3,5-bis(2-phenylethynyl)phenyl]prop-2-enoxy]phenyl]-2-ethoxypropanoate (PubChem CID 10280973) has the molecular formula C38H34O4 and a molecular weight of 554.69 g/mol. Its IUPAC name is ethyl 3-[4-[(E)-3-[3,5-bis(2-phenylethynyl)phenyl]prop-2-enoxy]phenyl]-2-ethoxypropanoate.
| Compound Name | ethyl 3-[4-[(E)-3-[3,5-bis(2-phenylethynyl)phenyl]prop-2-enoxy]phenyl]-2-ethoxypropanoate |
|---|---|
| PubChem CID | 10280973 |
| Molecular Formula | C38H34O4 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | ethyl 3-[4-[(E)-3-[3,5-bis(2-phenylethynyl)phenyl]prop-2-enoxy]phenyl]-2-ethoxypropanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OC/C=C/c2cc(C#Cc3ccccc3)cc(C#Cc3ccccc3)c2)cc1)OCC |
| InChI | InChI=1S/C38H34O4/c1-3-40-37(38(39)41-4-2)29-32-21-23-36(24-22-32)42-25-11-16-33-26-34(19-17-30-12-7-5-8-13-30)28-35(27-33)20-18-31-14-9-6-10-15-31/h5-16,21-24,26-28,37H,3-4,25,29H2,1-2H3/b16-11+ |
| InChIKey | FHTFNLWNIDJOCI-LFIBNONCSA-N |
| XLogP | 7.09 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|