C30H30O4 — CID 87999663
ethyl (2S)-2-ethoxy-3-[4-[(E)-3-phenanthren-9-ylprop-2-enoxy]phenyl]propanoate (PubChem CID 87999663) has the molecular formula C30H30O4 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethyl (2S)-2-ethoxy-3-[4-[(E)-3-phenanthren-9-ylprop-2-enoxy]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-ethoxy-3-[4-[(E)-3-phenanthren-9-ylprop-2-enoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 87999663 |
| Molecular Formula | C30H30O4 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | ethyl (2S)-2-ethoxy-3-[4-[(E)-3-phenanthren-9-ylprop-2-enoxy]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OC/C=C/c2cc3ccccc3c3ccccc23)cc1)OCC |
| InChI | InChI=1S/C30H30O4/c1-3-32-29(30(31)33-4-2)20-22-15-17-25(18-16-22)34-19-9-11-24-21-23-10-5-6-12-26(23)28-14-8-7-13-27(24)28/h5-18,21,29H,3-4,19-20H2,1-2H3/b11-9+/t29-/m0/s1 |
| InChIKey | BXQGBOGGOJKDJG-KENNHUPKSA-N |
| XLogP | 6.60 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|