C24H26O4 — CID 87841499
ethyl (2S)-2-ethoxy-3-[4-[(Z)-5-phenylpent-2-en-4-ynoxy]phenyl]propanoate (PubChem CID 87841499) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl (2S)-2-ethoxy-3-[4-[(Z)-5-phenylpent-2-en-4-ynoxy]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-ethoxy-3-[4-[(Z)-5-phenylpent-2-en-4-ynoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 87841499 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | ethyl (2S)-2-ethoxy-3-[4-[(Z)-5-phenylpent-2-en-4-ynoxy]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OC/C=C\C#Cc2ccccc2)cc1)OCC |
| InChI | InChI=1S/C24H26O4/c1-3-26-23(24(25)27-4-2)19-21-14-16-22(17-15-21)28-18-10-6-9-13-20-11-7-5-8-12-20/h5-8,10-12,14-17,23H,3-4,18-19H2,1-2H3/b10-6-/t23-/m0/s1 |
| InChIKey | DZSYJXNOEAYDFC-ZJZKVMBWSA-N |
| XLogP | 4.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|