C29H30O4 — CID 23445763
ethyl 3-[4-(2-fluoren-9-ylideneethoxy)phenyl]-2-propoxypropanoate (PubChem CID 23445763) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is ethyl 3-[4-(2-fluoren-9-ylideneethoxy)phenyl]-2-propoxypropanoate.
| Compound Name | ethyl 3-[4-(2-fluoren-9-ylideneethoxy)phenyl]-2-propoxypropanoate |
|---|---|
| PubChem CID | 23445763 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | ethyl 3-[4-(2-fluoren-9-ylideneethoxy)phenyl]-2-propoxypropanoate |
| SMILES | CCCOC(Cc1ccc(OCC=C2c3ccccc3-c3ccccc32)cc1)C(=O)OCC |
| InChI | InChI=1S/C29H30O4/c1-3-18-33-28(29(30)31-4-2)20-21-13-15-22(16-14-21)32-19-17-27-25-11-7-5-9-23(25)24-10-6-8-12-26(24)27/h5-17,28H,3-4,18-20H2,1-2H3 |
| InChIKey | YOQROAVDUZWVEQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |