C29H30O4 — CID 23445778
3-[4-(4-fluoren-9-ylidenebutoxy)phenyl]-2-propoxypropanoic acid (PubChem CID 23445778) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 3-[4-(4-fluoren-9-ylidenebutoxy)phenyl]-2-propoxypropanoic acid.
| Compound Name | 3-[4-(4-fluoren-9-ylidenebutoxy)phenyl]-2-propoxypropanoic acid |
|---|---|
| PubChem CID | 23445778 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 3-[4-(4-fluoren-9-ylidenebutoxy)phenyl]-2-propoxypropanoic acid |
| SMILES | CCCOC(Cc1ccc(OCCCC=C2c3ccccc3-c3ccccc32)cc1)C(=O)O |
| InChI | InChI=1S/C29H30O4/c1-2-18-33-28(29(30)31)20-21-14-16-22(17-15-21)32-19-8-7-13-27-25-11-5-3-9-23(25)24-10-4-6-12-26(24)27/h3-6,9-17,28H,2,7-8,18-20H2,1H3,(H,30,31) |
| InChIKey | KOIALYCUNXPRQV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|