C30H32O4 — CID 91063331
3-[4-[2-(3-butan-2-ylfluoren-9-ylidene)ethoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 91063331) has the molecular formula C30H32O4 and a molecular weight of 456.58 g/mol. Its IUPAC name is 3-[4-[2-(3-butan-2-ylfluoren-9-ylidene)ethoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[2-(3-butan-2-ylfluoren-9-ylidene)ethoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 91063331 |
| Molecular Formula | C30H32O4 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-[4-[2-(3-butan-2-ylfluoren-9-ylidene)ethoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCC=C2c3ccccc3-c3cc(C(C)CC)ccc32)cc1)C(=O)O |
| InChI | InChI=1S/C30H32O4/c1-4-20(3)22-12-15-26-27(24-8-6-7-9-25(24)28(26)19-22)16-17-34-23-13-10-21(11-14-23)18-29(30(31)32)33-5-2/h6-16,19-20,29H,4-5,17-18H2,1-3H3,(H,31,32) |
| InChIKey | BVWWPCMCSGFLLJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |