C32H36O5 — CID 23446036
ethyl 3-[4-[(2E)-2-(4-butoxyfluoren-9-ylidene)ethoxy]phenyl]-2-ethoxypropanoate (PubChem CID 23446036) has the molecular formula C32H36O5 and a molecular weight of 500.64 g/mol. Its IUPAC name is ethyl 3-[4-[(2E)-2-(4-butoxyfluoren-9-ylidene)ethoxy]phenyl]-2-ethoxypropanoate.
| Compound Name | ethyl 3-[4-[(2E)-2-(4-butoxyfluoren-9-ylidene)ethoxy]phenyl]-2-ethoxypropanoate |
|---|---|
| PubChem CID | 23446036 |
| Molecular Formula | C32H36O5 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | ethyl 3-[4-[(2E)-2-(4-butoxyfluoren-9-ylidene)ethoxy]phenyl]-2-ethoxypropanoate |
| SMILES | CCCCOc1cccc2c1-c1ccccc1/C2=C\COc1ccc(CC(OCC)C(=O)OCC)cc1 |
| InChI | InChI=1S/C32H36O5/c1-4-7-20-37-29-14-10-13-28-26(25-11-8-9-12-27(25)31(28)29)19-21-36-24-17-15-23(16-18-24)22-30(34-5-2)32(33)35-6-3/h8-19,30H,4-7,20-22H2,1-3H3/b26-19+ |
| InChIKey | DZLHADHUOAIJRI-LGUFXXKBSA-N |
| XLogP | 6.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|