C27H26O4 — CID 10273235
(2S)-2-ethoxy-3-[4-[(E)-3-methyl-5-naphthalen-1-ylpent-2-en-4-ynoxy]phenyl]propanoic acid (PubChem CID 10273235) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[(E)-3-methyl-5-naphthalen-1-ylpent-2-en-4-ynoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[(E)-3-methyl-5-naphthalen-1-ylpent-2-en-4-ynoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10273235 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[(E)-3-methyl-5-naphthalen-1-ylpent-2-en-4-ynoxy]phenyl]propanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OC/C=C(\C)C#Cc2cccc3ccccc23)cc1)C(=O)O |
| InChI | InChI=1S/C27H26O4/c1-3-30-26(27(28)29)19-21-12-15-24(16-13-21)31-18-17-20(2)11-14-23-9-6-8-22-7-4-5-10-25(22)23/h4-10,12-13,15-17,26H,3,18-19H2,1-2H3,(H,28,29)/b20-17+/t26-/m0/s1 |
| InChIKey | QDLLZQHWSYAJFO-GDNFTRMYSA-N |
| XLogP | 5.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|