C23H21F2IO4 — CID 10279871
3-[4-[(Z)-5-(3,5-difluorophenyl)-3-methylpent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid (PubChem CID 10279871) has the molecular formula C23H21F2IO4 and a molecular weight of 526.32 g/mol. Its IUPAC name is 3-[4-[(Z)-5-(3,5-difluorophenyl)-3-methylpent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[(Z)-5-(3,5-difluorophenyl)-3-methylpent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 10279871 |
| Molecular Formula | C23H21F2IO4 |
| Molecular Weight | 526.32 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 3-[4-[(Z)-5-(3,5-difluorophenyl)-3-methylpent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OC/C=C(/C)C#Cc2cc(F)cc(F)c2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C23H21F2IO4/c1-3-29-22(23(27)28)13-17-6-7-21(20(26)12-17)30-9-8-15(2)4-5-16-10-18(24)14-19(25)11-16/h6-8,10-12,14,22H,3,9,13H2,1-2H3,(H,27,28)/b15-8- |
| InChIKey | ZMENIYPJLAYTIQ-NVNXTCNLSA-N |
| XLogP | 4.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|