C26H25F6IO6 — CID 173170751
(2S)-3-[4-[5-[1,5-bis(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-yl]pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid (PubChem CID 173170751) has the molecular formula C26H25F6IO6 and a molecular weight of 674.37 g/mol. Its IUPAC name is (2S)-3-[4-[5-[1,5-bis(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-yl]pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[5-[1,5-bis(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-yl]pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 173170751 |
| Molecular Formula | C26H25F6IO6 |
| Molecular Weight | 674.37 g/mol |
| Exact Mass | 674.06 |
| IUPAC Name | (2S)-3-[4-[5-[1,5-bis(2,2,2-trifluoroethoxy)cyclohexa-2,4-dien-1-yl]pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OCC=CC#CC2(OCC(F)(F)F)C=CC=C(OCC(F)(F)F)C2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C26H25F6IO6/c1-2-36-22(23(34)35)14-18-8-9-21(20(33)13-18)37-12-5-3-4-10-24(39-17-26(30,31)32)11-6-7-19(15-24)38-16-25(27,28)29/h3,5-9,11,13,22H,2,12,14-17H2,1H3,(H,34,35)/t22-,24?/m0/s1 |
| InChIKey | CAQZGKQEISXDLZ-OWJIYDKWSA-N |
| XLogP | 6.00 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.37 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|