C24H27IO6 — CID 87841665
(2S)-3-[4-[(E)-5-(1,5-dimethoxycyclohexa-2,4-dien-1-yl)pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid (PubChem CID 87841665) has the molecular formula C24H27IO6 and a molecular weight of 538.38 g/mol. Its IUPAC name is (2S)-3-[4-[(E)-5-(1,5-dimethoxycyclohexa-2,4-dien-1-yl)pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid.
| Compound Name | (2S)-3-[4-[(E)-5-(1,5-dimethoxycyclohexa-2,4-dien-1-yl)pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 87841665 |
| Molecular Formula | C24H27IO6 |
| Molecular Weight | 538.38 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | (2S)-3-[4-[(E)-5-(1,5-dimethoxycyclohexa-2,4-dien-1-yl)pent-2-en-4-ynoxy]-3-iodophenyl]-2-ethoxypropanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OC/C=C/C#CC2(OC)C=CC=C(OC)C2)c(I)c1)C(=O)O |
| InChI | InChI=1S/C24H27IO6/c1-4-30-22(23(26)27)16-18-10-11-21(20(25)15-18)31-14-7-5-6-12-24(29-3)13-8-9-19(17-24)28-2/h5,7-11,13,15,22H,4,14,16-17H2,1-3H3,(H,26,27)/b7-5+/t22-,24?/m0/s1 |
| InChIKey | YSWLVUVQFPLBDN-VDGVVHNXSA-N |
| XLogP | 4.14 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|