C25H30O6 — CID 87840958
(2S)-3-[4-[(E)-5-(1,5-dimethoxycyclohexa-2,4-dien-1-yl)pent-2-en-4-ynoxy]phenyl]-2-ethoxybutanoic acid (PubChem CID 87840958) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is (2S)-3-[4-[(E)-5-(1,5-dimethoxycyclohexa-2,4-dien-1-yl)pent-2-en-4-ynoxy]phenyl]-2-ethoxybutanoic acid.
| Compound Name | (2S)-3-[4-[(E)-5-(1,5-dimethoxycyclohexa-2,4-dien-1-yl)pent-2-en-4-ynoxy]phenyl]-2-ethoxybutanoic acid |
|---|---|
| PubChem CID | 87840958 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | (2S)-3-[4-[(E)-5-(1,5-dimethoxycyclohexa-2,4-dien-1-yl)pent-2-en-4-ynoxy]phenyl]-2-ethoxybutanoic acid |
| SMILES | CCO[C@H](C(=O)O)C(C)c1ccc(OC/C=C/C#CC2(OC)C=CC=C(OC)C2)cc1 |
| InChI | InChI=1S/C25H30O6/c1-5-30-23(24(26)27)19(2)20-11-13-21(14-12-20)31-17-8-6-7-15-25(29-4)16-9-10-22(18-25)28-3/h6,8-14,16,19,23H,5,17-18H2,1-4H3,(H,26,27)/b8-6+/t19?,23-,25?/m0/s1 |
| InChIKey | JTOPUSNCDKUGJU-BBCNVBMOSA-N |
| XLogP | 4.09 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|