C29H31ClO4 — CID 90904748
ethyl (2S)-3-[4-[3-[4-(4-chlorophenyl)phenyl]but-2-enoxy]phenyl]-2-ethoxypropanoate (PubChem CID 90904748) has the molecular formula C29H31ClO4 and a molecular weight of 479.02 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[3-[4-(4-chlorophenyl)phenyl]but-2-enoxy]phenyl]-2-ethoxypropanoate.
| Compound Name | ethyl (2S)-3-[4-[3-[4-(4-chlorophenyl)phenyl]but-2-enoxy]phenyl]-2-ethoxypropanoate |
|---|---|
| PubChem CID | 90904748 |
| Molecular Formula | C29H31ClO4 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | ethyl (2S)-3-[4-[3-[4-(4-chlorophenyl)phenyl]but-2-enoxy]phenyl]-2-ethoxypropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCC=C(C)c2ccc(-c3ccc(Cl)cc3)cc2)cc1)OCC |
| InChI | InChI=1S/C29H31ClO4/c1-4-32-28(29(31)33-5-2)20-22-6-16-27(17-7-22)34-19-18-21(3)23-8-10-24(11-9-23)25-12-14-26(30)15-13-25/h6-18,28H,4-5,19-20H2,1-3H3/t28-/m0/s1 |
| InChIKey | CEGIJQVKAZKLEU-NDEPHWFRSA-N |
| XLogP | 7.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |