C29H32O5 — CID 22557556
2-ethoxy-3-[4-[(E)-3-[4-[3-(1-hydroxyethyl)phenyl]phenyl]but-2-enoxy]phenyl]propanoic acid (PubChem CID 22557556) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is 2-ethoxy-3-[4-[(E)-3-[4-[3-(1-hydroxyethyl)phenyl]phenyl]but-2-enoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[4-[(E)-3-[4-[3-(1-hydroxyethyl)phenyl]phenyl]but-2-enoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22557556 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 2-ethoxy-3-[4-[(E)-3-[4-[3-(1-hydroxyethyl)phenyl]phenyl]but-2-enoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OC/C=C(\C)c2ccc(-c3cccc(C(C)O)c3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H32O5/c1-4-33-28(29(31)32)18-22-8-14-27(15-9-22)34-17-16-20(2)23-10-12-24(13-11-23)26-7-5-6-25(19-26)21(3)30/h5-16,19,21,28,30H,4,17-18H2,1-3H3,(H,31,32)/b20-16+ |
| InChIKey | FPSVFACBOJKQAS-CAPFRKAQSA-N |
| XLogP | 5.92 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |