C25H33NO4 — CID 175113864
4-O-tert-butyl 1-O-ethyl 2-amino-3-ethyl-2-methyl-3-(4-phenylphenyl)butanedioate (PubChem CID 175113864) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl 2-amino-3-ethyl-2-methyl-3-(4-phenylphenyl)butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-ethyl 2-amino-3-ethyl-2-methyl-3-(4-phenylphenyl)butanedioate |
|---|---|
| PubChem CID | 175113864 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-O-tert-butyl 1-O-ethyl 2-amino-3-ethyl-2-methyl-3-(4-phenylphenyl)butanedioate |
| SMILES | CCOC(=O)C(C)(N)C(CC)(C(=O)OC(C)(C)C)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-7-25(22(28)30-23(3,4)5,24(6,26)21(27)29-8-2)20-16-14-19(15-17-20)18-12-10-9-11-13-18/h9-17H,7-8,26H2,1-6H3 |
| InChIKey | YBIFBFUPFRVDCW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |