C24H26FN3O4 — CID 70376745
7-[6-cyclopropyl-1-ethyl-4-(4-fluorophenyl)pyrazolo[3,4-b]pyridin-5-yl]-2,2-dihydroxyhept-6-enoic acid (PubChem CID 70376745) has the molecular formula C24H26FN3O4 and a molecular weight of 439.49 g/mol. Its IUPAC name is 7-[6-cyclopropyl-1-ethyl-4-(4-fluorophenyl)pyrazolo[3,4-b]pyridin-5-yl]-2,2-dihydroxyhept-6-enoic acid.
| Compound Name | 7-[6-cyclopropyl-1-ethyl-4-(4-fluorophenyl)pyrazolo[3,4-b]pyridin-5-yl]-2,2-dihydroxyhept-6-enoic acid |
|---|---|
| PubChem CID | 70376745 |
| Molecular Formula | C24H26FN3O4 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 7-[6-cyclopropyl-1-ethyl-4-(4-fluorophenyl)pyrazolo[3,4-b]pyridin-5-yl]-2,2-dihydroxyhept-6-enoic acid |
| SMILES | CCn1ncc2c(-c3ccc(F)cc3)c(C=CCCCC(O)(O)C(=O)O)c(C3CC3)nc21 |
| InChI | InChI=1S/C24H26FN3O4/c1-2-28-22-19(14-26-28)20(15-9-11-17(25)12-10-15)18(21(27-22)16-7-8-16)6-4-3-5-13-24(31,32)23(29)30/h4,6,9-12,14,16,31-32H,2-3,5,7-8,13H2,1H3,(H,29,30) |
| InChIKey | AWYZPIWZDDPSKX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|