C21H26FNO — CID 22004996
[4-(4-fluorophenyl)-2-methyl-5-[(E)-pent-1-enyl]-6-propan-2-yl-3-pyridinyl]methanol (PubChem CID 22004996) has the molecular formula C21H26FNO and a molecular weight of 327.44 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-methyl-5-[(E)-pent-1-enyl]-6-propan-2-yl-3-pyridinyl]methanol.
| Compound Name | [4-(4-fluorophenyl)-2-methyl-5-[(E)-pent-1-enyl]-6-propan-2-yl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 22004996 |
| Molecular Formula | C21H26FNO |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | [4-(4-fluorophenyl)-2-methyl-5-[(E)-pent-1-enyl]-6-propan-2-yl-3-pyridinyl]methanol |
| SMILES | CCC/C=C/c1c(C(C)C)nc(C)c(CO)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FNO/c1-5-6-7-8-18-20(16-9-11-17(22)12-10-16)19(13-24)15(4)23-21(18)14(2)3/h7-12,14,24H,5-6,13H2,1-4H3/b8-7+ |
| InChIKey | HBPCBCZMMCCBIC-BQYQJAHWSA-N |
| XLogP | 5.63 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |