C24H35NO — CID 22004877
[4-(4-methylphenyl)-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol (PubChem CID 22004877) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is [4-(4-methylphenyl)-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol.
| Compound Name | [4-(4-methylphenyl)-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 22004877 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | [4-(4-methylphenyl)-5-pentyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
| SMILES | CCCCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H35NO/c1-7-8-9-10-20-22(19-13-11-18(6)12-14-19)21(15-26)24(17(4)5)25-23(20)16(2)3/h11-14,16-17,26H,7-10,15H2,1-6H3 |
| InChIKey | FHPWUWXBZPBBSL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|