C24H34FNO — CID 22005015
[4-(4-fluorophenyl)-5-hexyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol (PubChem CID 22005015) has the molecular formula C24H34FNO and a molecular weight of 371.54 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-5-hexyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol.
| Compound Name | [4-(4-fluorophenyl)-5-hexyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 22005015 |
| Molecular Formula | C24H34FNO |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | [4-(4-fluorophenyl)-5-hexyl-2,6-di(propan-2-yl)-3-pyridinyl]methanol |
| SMILES | CCCCCCc1c(C(C)C)nc(C(C)C)c(CO)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H34FNO/c1-6-7-8-9-10-20-22(18-11-13-19(25)14-12-18)21(15-27)24(17(4)5)26-23(20)16(2)3/h11-14,16-17,27H,6-10,15H2,1-5H3 |
| InChIKey | XLGVIPRRJYUYBR-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|