C27H26FNO4 — CID 97041195
ethyl (Z,5R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate (PubChem CID 97041195) has the molecular formula C27H26FNO4 and a molecular weight of 447.51 g/mol. Its IUPAC name is ethyl (Z,5R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate.
| Compound Name | ethyl (Z,5R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 97041195 |
| Molecular Formula | C27H26FNO4 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | ethyl (Z,5R)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate |
| SMILES | CCOC(=O)CC(=O)C[C@@H](O)/C=C\c1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C27H26FNO4/c1-2-33-25(32)16-21(31)15-20(30)13-14-23-26(17-9-11-19(28)12-10-17)22-5-3-4-6-24(22)29-27(23)18-7-8-18/h3-6,9-14,18,20,30H,2,7-8,15-16H2,1H3/b14-13-/t20-/m0/s1 |
| InChIKey | DPBQVLWVWXLRGW-ODLZTCLXSA-N |
| XLogP | 5.20 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|