C28H26F3NO4 — CID 11477504
ethyl (E,5S)-7-[2-cyclopropyl-4-[4-(trifluoromethyl)phenyl]quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate (PubChem CID 11477504) has the molecular formula C28H26F3NO4 and a molecular weight of 497.51 g/mol. Its IUPAC name is ethyl (E,5S)-7-[2-cyclopropyl-4-[4-(trifluoromethyl)phenyl]quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate.
| Compound Name | ethyl (E,5S)-7-[2-cyclopropyl-4-[4-(trifluoromethyl)phenyl]quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 11477504 |
| Molecular Formula | C28H26F3NO4 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | ethyl (E,5S)-7-[2-cyclopropyl-4-[4-(trifluoromethyl)phenyl]quinolin-3-yl]-5-hydroxy-3-oxohept-6-enoate |
| SMILES | CCOC(=O)CC(=O)C[C@H](O)/C=C/c1c(C2CC2)nc2ccccc2c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H26F3NO4/c1-2-36-25(35)16-21(34)15-20(33)13-14-23-26(17-9-11-19(12-10-17)28(29,30)31)22-5-3-4-6-24(22)32-27(23)18-7-8-18/h3-6,9-14,18,20,33H,2,7-8,15-16H2,1H3/b14-13+/t20-/m1/s1 |
| InChIKey | JGXHKRCKKOOGJI-FBRRREGBSA-N |
| XLogP | 6.08 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|