C28H28FNO5 — CID 142159863
ethyl 7-[2-cyclobutyl-4-(4-fluorophenyl)quinolin-3-yl]-7-hydroxy-3,5-dioxoheptanoate (PubChem CID 142159863) has the molecular formula C28H28FNO5 and a molecular weight of 477.53 g/mol. Its IUPAC name is ethyl 7-[2-cyclobutyl-4-(4-fluorophenyl)quinolin-3-yl]-7-hydroxy-3,5-dioxoheptanoate.
| Compound Name | ethyl 7-[2-cyclobutyl-4-(4-fluorophenyl)quinolin-3-yl]-7-hydroxy-3,5-dioxoheptanoate |
|---|---|
| PubChem CID | 142159863 |
| Molecular Formula | C28H28FNO5 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | ethyl 7-[2-cyclobutyl-4-(4-fluorophenyl)quinolin-3-yl]-7-hydroxy-3,5-dioxoheptanoate |
| SMILES | CCOC(=O)CC(=O)CC(=O)CC(O)c1c(C2CCC2)nc2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H28FNO5/c1-2-35-25(34)16-21(32)14-20(31)15-24(33)27-26(17-10-12-19(29)13-11-17)22-8-3-4-9-23(22)30-28(27)18-6-5-7-18/h3-4,8-13,18,24,33H,2,5-7,14-16H2,1H3 |
| InChIKey | AMCRFMKSFYKBIX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|