C18H15FN2 — CID 163732207
2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-amine (PubChem CID 163732207) has the molecular formula C18H15FN2 and a molecular weight of 278.33 g/mol. Its IUPAC name is 2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-amine.
| Compound Name | 2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-amine |
|---|---|
| PubChem CID | 163732207 |
| Molecular Formula | C18H15FN2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-amine |
| SMILES | Nc1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2/c19-13-9-7-11(8-10-13)16-14-3-1-2-4-15(14)21-18(17(16)20)12-5-6-12/h1-4,7-10,12H,5-6,20H2 |
| InChIKey | LANWECUKPYQQAZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |