C25H30BrFNO3P — CID 142709376
bromo-[[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methyl]-triethoxy-λ5-phosphane (PubChem CID 142709376) has the molecular formula C25H30BrFNO3P and a molecular weight of 522.40 g/mol. Its IUPAC name is bromo-[[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methyl]-triethoxy-λ5-phosphane.
| Compound Name | bromo-[[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methyl]-triethoxy-λ5-phosphane |
|---|---|
| PubChem CID | 142709376 |
| Molecular Formula | C25H30BrFNO3P |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | bromo-[[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methyl]-triethoxy-λ5-phosphane |
| SMILES | CCOP(Br)(Cc1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1)(OCC)OCC |
| InChI | InChI=1S/C25H30BrFNO3P/c1-4-29-32(26,30-5-2,31-6-3)17-22-24(18-13-15-20(27)16-14-18)21-9-7-8-10-23(21)28-25(22)19-11-12-19/h7-10,13-16,19H,4-6,11-12,17H2,1-3H3 |
| InChIKey | GEANEITYPHQZHL-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|