C19H18FNO — CID 15125323
[4-(4-fluorophenyl)-2-propylquinolin-3-yl]methanol (PubChem CID 15125323) has the molecular formula C19H18FNO and a molecular weight of 295.36 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2-propylquinolin-3-yl]methanol.
| Compound Name | [4-(4-fluorophenyl)-2-propylquinolin-3-yl]methanol |
|---|---|
| PubChem CID | 15125323 |
| Molecular Formula | C19H18FNO |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | [4-(4-fluorophenyl)-2-propylquinolin-3-yl]methanol |
| SMILES | CCCc1nc2ccccc2c(-c2ccc(F)cc2)c1CO |
| InChI | InChI=1S/C19H18FNO/c1-2-5-17-16(12-22)19(13-8-10-14(20)11-9-13)15-6-3-4-7-18(15)21-17/h3-4,6-11,22H,2,5,12H2,1H3 |
| InChIKey | PWFRYZYNXFRDOA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |