C10H7F2NO — CID 123381808
(3,4-difluoroquinolin-2-yl)methanol (PubChem CID 123381808) has the molecular formula C10H7F2NO and a molecular weight of 195.17 g/mol. Its IUPAC name is (3,4-difluoroquinolin-2-yl)methanol.
| Compound Name | (3,4-difluoroquinolin-2-yl)methanol |
|---|---|
| PubChem CID | 123381808 |
| Molecular Formula | C10H7F2NO |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | (3,4-difluoroquinolin-2-yl)methanol |
| SMILES | OCc1nc2ccccc2c(F)c1F |
| InChI | InChI=1S/C10H7F2NO/c11-9-6-3-1-2-4-7(6)13-8(5-14)10(9)12/h1-4,14H,5H2 |
| InChIKey | NRZSZVWVAKIDLA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |