2,4-difluoroquinoline-3-carboxylic acid;hydrochloride

C10H6ClF2NO2 — CID 141031168

IUPAC2,4-difluoroquinoline-3-carboxylic acid;hydrochloride
SMILESCl.O=C(O)c1c(F)nc2ccccc2c1F
InChIInChI=1S/C10H5F2NO2.ClH/c11-8-5-3-1-2-4-6(5)13-9(12)7(8)10(14)15;/h1-4H,(H,14,15);1H
InChIKeyYPJVOABMGDWPGG-UHFFFAOYSA-N
MW245.61 g/mol
LogP2.63
Rot. Bonds1

About 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride

2,4-difluoroquinoline-3-carboxylic acid;hydrochloride (PubChem CID 141031168) has the molecular formula C10H6ClF2NO2 and a molecular weight of 245.61 g/mol. Its IUPAC name is 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride.

Molecular Properties

Compound Name2,4-difluoroquinoline-3-carboxylic acid;hydrochloride
PubChem CID141031168
Molecular FormulaC10H6ClF2NO2
Molecular Weight245.61 g/mol
Exact Mass245.01
IUPAC Name2,4-difluoroquinoline-3-carboxylic acid;hydrochloride
SMILESCl.O=C(O)c1c(F)nc2ccccc2c1F
InChIInChI=1S/C10H5F2NO2.ClH/c11-8-5-3-1-2-4-6(5)13-9(12)7(8)10(14)15;/h1-4H,(H,14,15);1H
InChIKeyYPJVOABMGDWPGG-UHFFFAOYSA-N
XLogP2.63
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.61
LogP ≤ 52.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride?
The IUPAC name of 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride (CID 141031168) is 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride.
What is the SMILES notation for 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride?
The canonical SMILES for 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride is Cl.O=C(O)c1c(F)nc2ccccc2c1F.
What is the InChIKey of 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride?
The InChIKey is YPJVOABMGDWPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F2NO2.ClH/c11-8-5-3-1-2-4-6(5)13-9(12)7(8)10(14)15;/h1-4H,(H,14,15);1H.
What are the key properties of 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride?
2,4-difluoroquinoline-3-carboxylic acid;hydrochloride has a molecular weight of 245.61 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoroquinoline-3-carboxylic acid;hydrochloride is sourced from PubChem (CID 141031168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).