C18H17NO2 — CID 68508380
(3-methyl-4-phenylmethoxyquinolin-2-yl)methanol (PubChem CID 68508380) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is (3-methyl-4-phenylmethoxyquinolin-2-yl)methanol.
| Compound Name | (3-methyl-4-phenylmethoxyquinolin-2-yl)methanol |
|---|---|
| PubChem CID | 68508380 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (3-methyl-4-phenylmethoxyquinolin-2-yl)methanol |
| SMILES | Cc1c(CO)nc2ccccc2c1OCc1ccccc1 |
| InChI | InChI=1S/C18H17NO2/c1-13-17(11-20)19-16-10-6-5-9-15(16)18(13)21-12-14-7-3-2-4-8-14/h2-10,20H,11-12H2,1H3 |
| InChIKey | RWADIOXBPYJDJD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |