C29H32N2O4 — CID 59526863
2-[[4-(3-methoxy-3-methylbutoxy)-2-pyridinyl]oxymethyl]-3-methyl-4-phenylmethoxyquinoline (PubChem CID 59526863) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[[4-(3-methoxy-3-methylbutoxy)-2-pyridinyl]oxymethyl]-3-methyl-4-phenylmethoxyquinoline.
| Compound Name | 2-[[4-(3-methoxy-3-methylbutoxy)-2-pyridinyl]oxymethyl]-3-methyl-4-phenylmethoxyquinoline |
|---|---|
| PubChem CID | 59526863 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 2-[[4-(3-methoxy-3-methylbutoxy)-2-pyridinyl]oxymethyl]-3-methyl-4-phenylmethoxyquinoline |
| SMILES | COC(C)(C)CCOc1ccnc(OCc2nc3ccccc3c(OCc3ccccc3)c2C)c1 |
| InChI | InChI=1S/C29H32N2O4/c1-21-26(20-34-27-18-23(14-16-30-27)33-17-15-29(2,3)32-4)31-25-13-9-8-12-24(25)28(21)35-19-22-10-6-5-7-11-22/h5-14,16,18H,15,17,19-20H2,1-4H3 |
| InChIKey | QSWHOOWWQAJOEB-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |