C26H32N2O4 — CID 70839489
4-butoxy-3-methyl-2-[[2-(oxan-4-ylmethoxy)-4-pyridinyl]oxymethyl]quinoline (PubChem CID 70839489) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 4-butoxy-3-methyl-2-[[2-(oxan-4-ylmethoxy)-4-pyridinyl]oxymethyl]quinoline.
| Compound Name | 4-butoxy-3-methyl-2-[[2-(oxan-4-ylmethoxy)-4-pyridinyl]oxymethyl]quinoline |
|---|---|
| PubChem CID | 70839489 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 4-butoxy-3-methyl-2-[[2-(oxan-4-ylmethoxy)-4-pyridinyl]oxymethyl]quinoline |
| SMILES | CCCCOc1c(C)c(COc2ccnc(OCC3CCOCC3)c2)nc2ccccc12 |
| InChI | InChI=1S/C26H32N2O4/c1-3-4-13-30-26-19(2)24(28-23-8-6-5-7-22(23)26)18-31-21-9-12-27-25(16-21)32-17-20-10-14-29-15-11-20/h5-9,12,16,20H,3-4,10-11,13-15,17-18H2,1-2H3 |
| InChIKey | PLVMQOCNBHSOMH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|