C27H34N2O5 — CID 89063758
4-butoxy-2-[[3-methoxy-5-(3-methyl-3-nitrosobutoxy)phenoxy]methyl]-3-methylquinoline (PubChem CID 89063758) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is 4-butoxy-2-[[3-methoxy-5-(3-methyl-3-nitrosobutoxy)phenoxy]methyl]-3-methylquinoline.
| Compound Name | 4-butoxy-2-[[3-methoxy-5-(3-methyl-3-nitrosobutoxy)phenoxy]methyl]-3-methylquinoline |
|---|---|
| PubChem CID | 89063758 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 4-butoxy-2-[[3-methoxy-5-(3-methyl-3-nitrosobutoxy)phenoxy]methyl]-3-methylquinoline |
| SMILES | CCCCOc1c(C)c(COc2cc(OC)cc(OCCC(C)(C)N=O)c2)nc2ccccc12 |
| InChI | InChI=1S/C27H34N2O5/c1-6-7-13-33-26-19(2)25(28-24-11-9-8-10-23(24)26)18-34-22-16-20(31-5)15-21(17-22)32-14-12-27(3,4)29-30/h8-11,15-17H,6-7,12-14,18H2,1-5H3 |
| InChIKey | CGWLWPOBAXHYGI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|