C31H42N2O4 — CID 70839437
4-[1-[3-[(4-butoxy-3-methylquinolin-2-yl)methoxy]phenyl]piperidin-4-yl]oxy-2-methylbutan-2-ol (PubChem CID 70839437) has the molecular formula C31H42N2O4 and a molecular weight of 506.69 g/mol. Its IUPAC name is 4-[1-[3-[(4-butoxy-3-methylquinolin-2-yl)methoxy]phenyl]piperidin-4-yl]oxy-2-methylbutan-2-ol.
| Compound Name | 4-[1-[3-[(4-butoxy-3-methylquinolin-2-yl)methoxy]phenyl]piperidin-4-yl]oxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 70839437 |
| Molecular Formula | C31H42N2O4 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | 4-[1-[3-[(4-butoxy-3-methylquinolin-2-yl)methoxy]phenyl]piperidin-4-yl]oxy-2-methylbutan-2-ol |
| SMILES | CCCCOc1c(C)c(COc2cccc(N3CCC(OCCC(C)(C)O)CC3)c2)nc2ccccc12 |
| InChI | InChI=1S/C31H42N2O4/c1-5-6-19-36-30-23(2)29(32-28-13-8-7-12-27(28)30)22-37-26-11-9-10-24(21-26)33-17-14-25(15-18-33)35-20-16-31(3,4)34/h7-13,21,25,34H,5-6,14-20,22H2,1-4H3 |
| InChIKey | YATWGQWESNKOPU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|