C21H21BrFNO2 — CID 70839335
2-[(3-bromophenoxy)methyl]-4-butoxy-6-fluoro-3-methylquinoline (PubChem CID 70839335) has the molecular formula C21H21BrFNO2 and a molecular weight of 418.31 g/mol. Its IUPAC name is 2-[(3-bromophenoxy)methyl]-4-butoxy-6-fluoro-3-methylquinoline.
| Compound Name | 2-[(3-bromophenoxy)methyl]-4-butoxy-6-fluoro-3-methylquinoline |
|---|---|
| PubChem CID | 70839335 |
| Molecular Formula | C21H21BrFNO2 |
| Molecular Weight | 418.31 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[(3-bromophenoxy)methyl]-4-butoxy-6-fluoro-3-methylquinoline |
| SMILES | CCCCOc1c(C)c(COc2cccc(Br)c2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C21H21BrFNO2/c1-3-4-10-25-21-14(2)20(13-26-17-7-5-6-15(22)11-17)24-19-9-8-16(23)12-18(19)21/h5-9,11-12H,3-4,10,13H2,1-2H3 |
| InChIKey | UCGSXXJGHINURW-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.31 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|