C26H37FN2O3 — CID 70839305
1-[4-[(4-butoxy-6-fluoro-3-methylquinolin-2-yl)methoxy]piperidin-1-yl]hexan-1-one (PubChem CID 70839305) has the molecular formula C26H37FN2O3 and a molecular weight of 444.59 g/mol. Its IUPAC name is 1-[4-[(4-butoxy-6-fluoro-3-methylquinolin-2-yl)methoxy]piperidin-1-yl]hexan-1-one.
| Compound Name | 1-[4-[(4-butoxy-6-fluoro-3-methylquinolin-2-yl)methoxy]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 70839305 |
| Molecular Formula | C26H37FN2O3 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 1-[4-[(4-butoxy-6-fluoro-3-methylquinolin-2-yl)methoxy]piperidin-1-yl]hexan-1-one |
| SMILES | CCCCCC(=O)N1CCC(OCc2nc3ccc(F)cc3c(OCCCC)c2C)CC1 |
| InChI | InChI=1S/C26H37FN2O3/c1-4-6-8-9-25(30)29-14-12-21(13-15-29)32-18-24-19(3)26(31-16-7-5-2)22-17-20(27)10-11-23(22)28-24/h10-11,17,21H,4-9,12-16,18H2,1-3H3 |
| InChIKey | WUZHRGSBPLGKMK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|