C30H33NO4 — CID 59527442
2-methyl-5-[3-[(3-methyl-4-phenylmethoxyquinolin-2-yl)methoxy]phenoxy]pentan-2-ol (PubChem CID 59527442) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-methyl-5-[3-[(3-methyl-4-phenylmethoxyquinolin-2-yl)methoxy]phenoxy]pentan-2-ol.
| Compound Name | 2-methyl-5-[3-[(3-methyl-4-phenylmethoxyquinolin-2-yl)methoxy]phenoxy]pentan-2-ol |
|---|---|
| PubChem CID | 59527442 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 2-methyl-5-[3-[(3-methyl-4-phenylmethoxyquinolin-2-yl)methoxy]phenoxy]pentan-2-ol |
| SMILES | Cc1c(COc2cccc(OCCCC(C)(C)O)c2)nc2ccccc2c1OCc1ccccc1 |
| InChI | InChI=1S/C30H33NO4/c1-22-28(21-34-25-14-9-13-24(19-25)33-18-10-17-30(2,3)32)31-27-16-8-7-15-26(27)29(22)35-20-23-11-5-4-6-12-23/h4-9,11-16,19,32H,10,17-18,20-21H2,1-3H3 |
| InChIKey | LCFTWWXGUYRONL-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|